C16H34N4O — CID 111738153
N-ethyl-N'-[3-[2-methoxyethyl(methyl)amino]propyl]-3,3-dimethylpyrrolidine-1-carboximidamide (PubChem CID 111738153) has the molecular formula C16H34N4O and a molecular weight of 298.48 g/mol. Its IUPAC name is N-ethyl-N'-[3-[2-methoxyethyl(methyl)amino]propyl]-3,3-dimethylpyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[3-[2-methoxyethyl(methyl)amino]propyl]-3,3-dimethylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111738153 |
| Molecular Formula | C16H34N4O |
| Molecular Weight | 298.48 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | N-ethyl-N'-[3-[2-methoxyethyl(methyl)amino]propyl]-3,3-dimethylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCN(C)CCOC)N1CCC(C)(C)C1 |
| InChI | InChI=1S/C16H34N4O/c1-6-17-15(20-11-8-16(2,3)14-20)18-9-7-10-19(4)12-13-21-5/h6-14H2,1-5H3,(H,17,18) |
| InChIKey | DPVNNRLOGUZTIY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.48 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|