C18H39IN4 — CID 111740191
N'-[7-(dimethylamino)heptyl]-N-ethyl-3,3-dimethylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111740191) has the molecular formula C18H39IN4 and a molecular weight of 438.44 g/mol. Its IUPAC name is N'-[7-(dimethylamino)heptyl]-N-ethyl-3,3-dimethylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[7-(dimethylamino)heptyl]-N-ethyl-3,3-dimethylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111740191 |
| Molecular Formula | C18H39IN4 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | N'-[7-(dimethylamino)heptyl]-N-ethyl-3,3-dimethylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCCCCCN(C)C)N1CCC(C)(C)C1.I |
| InChI | InChI=1S/C18H38N4.HI/c1-6-19-17(22-15-12-18(2,3)16-22)20-13-10-8-7-9-11-14-21(4)5;/h6-16H2,1-5H3,(H,19,20);1H |
| InChIKey | HEXFFDFIUUJECD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|