C19H37N5O — CID 111740430
1-[4-[[(3,3-dimethylpyrrolidin-1-yl)-(ethylamino)methylidene]amino]butyl]piperidine-4-carboxamide (PubChem CID 111740430) has the molecular formula C19H37N5O and a molecular weight of 351.54 g/mol. Its IUPAC name is 1-[4-[[(3,3-dimethylpyrrolidin-1-yl)-(ethylamino)methylidene]amino]butyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-[[(3,3-dimethylpyrrolidin-1-yl)-(ethylamino)methylidene]amino]butyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 111740430 |
| Molecular Formula | C19H37N5O |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.30 |
| IUPAC Name | 1-[4-[[(3,3-dimethylpyrrolidin-1-yl)-(ethylamino)methylidene]amino]butyl]piperidine-4-carboxamide |
| SMILES | CCN/C(=N\CCCCN1CCC(C(N)=O)CC1)N1CCC(C)(C)C1 |
| InChI | InChI=1S/C19H37N5O/c1-4-21-18(24-14-9-19(2,3)15-24)22-10-5-6-11-23-12-7-16(8-13-23)17(20)25/h16H,4-15H2,1-3H3,(H2,20,25)(H,21,22) |
| InChIKey | RUERRDVGCCVFNQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|