C22H41N5O — CID 111744335
1-[4-[[2-azaspiro[4.5]decan-2-yl(ethylamino)methylidene]amino]butyl]piperidine-4-carboxamide (PubChem CID 111744335) has the molecular formula C22H41N5O and a molecular weight of 391.60 g/mol. Its IUPAC name is 1-[4-[[2-azaspiro[4.5]decan-2-yl(ethylamino)methylidene]amino]butyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-[[2-azaspiro[4.5]decan-2-yl(ethylamino)methylidene]amino]butyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 111744335 |
| Molecular Formula | C22H41N5O |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.33 |
| IUPAC Name | 1-[4-[[2-azaspiro[4.5]decan-2-yl(ethylamino)methylidene]amino]butyl]piperidine-4-carboxamide |
| SMILES | CCN/C(=N\CCCCN1CCC(C(N)=O)CC1)N1CCC2(CCCCC2)C1 |
| InChI | InChI=1S/C22H41N5O/c1-2-24-21(27-17-12-22(18-27)10-4-3-5-11-22)25-13-6-7-14-26-15-8-19(9-16-26)20(23)28/h19H,2-18H2,1H3,(H2,23,28)(H,24,25) |
| InChIKey | LDPRDFDQYHDBTG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|