C18H36N4O2S — CID 111745286
N-ethyl-N'-[3-[ethylsulfonyl(methyl)amino]propyl]-2-azaspiro[4.5]decane-2-carboximidamide (PubChem CID 111745286) has the molecular formula C18H36N4O2S and a molecular weight of 372.58 g/mol. Its IUPAC name is N-ethyl-N'-[3-[ethylsulfonyl(methyl)amino]propyl]-2-azaspiro[4.5]decane-2-carboximidamide.
| Compound Name | N-ethyl-N'-[3-[ethylsulfonyl(methyl)amino]propyl]-2-azaspiro[4.5]decane-2-carboximidamide |
|---|---|
| PubChem CID | 111745286 |
| Molecular Formula | C18H36N4O2S |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | N-ethyl-N'-[3-[ethylsulfonyl(methyl)amino]propyl]-2-azaspiro[4.5]decane-2-carboximidamide |
| SMILES | CCN/C(=N\CCCN(C)S(=O)(=O)CC)N1CCC2(CCCCC2)C1 |
| InChI | InChI=1S/C18H36N4O2S/c1-4-19-17(20-13-9-14-21(3)25(23,24)5-2)22-15-12-18(16-22)10-7-6-8-11-18/h4-16H2,1-3H3,(H,19,20) |
| InChIKey | JFQCLZFVRKCLDU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|