C16H28F3N3O — CID 111732513
N-ethyl-N'-[3-(2,2,2-trifluoroethoxy)propyl]-2-azaspiro[4.4]nonane-2-carboximidamide (PubChem CID 111732513) has the molecular formula C16H28F3N3O and a molecular weight of 335.41 g/mol. Its IUPAC name is N-ethyl-N'-[3-(2,2,2-trifluoroethoxy)propyl]-2-azaspiro[4.4]nonane-2-carboximidamide.
| Compound Name | N-ethyl-N'-[3-(2,2,2-trifluoroethoxy)propyl]-2-azaspiro[4.4]nonane-2-carboximidamide |
|---|---|
| PubChem CID | 111732513 |
| Molecular Formula | C16H28F3N3O |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | N-ethyl-N'-[3-(2,2,2-trifluoroethoxy)propyl]-2-azaspiro[4.4]nonane-2-carboximidamide |
| SMILES | CCN/C(=N\CCCOCC(F)(F)F)N1CCC2(CCCC2)C1 |
| InChI | InChI=1S/C16H28F3N3O/c1-2-20-14(21-9-5-11-23-13-16(17,18)19)22-10-8-15(12-22)6-3-4-7-15/h2-13H2,1H3,(H,20,21) |
| InChIKey | QQOXMZXHGPXEPZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|