C24H40IN5O3 — CID 111268842
1-[4-[[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(ethylamino)methylidene]amino]butyl]piperidine-4-carboxamide;hydroiodide (PubChem CID 111268842) has the molecular formula C24H40IN5O3 and a molecular weight of 573.52 g/mol. Its IUPAC name is 1-[4-[[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(ethylamino)methylidene]amino]butyl]piperidine-4-carboxamide;hydroiodide.
| Compound Name | 1-[4-[[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(ethylamino)methylidene]amino]butyl]piperidine-4-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111268842 |
| Molecular Formula | C24H40IN5O3 |
| Molecular Weight | 573.52 g/mol |
| Exact Mass | 573.22 |
| IUPAC Name | 1-[4-[[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-(ethylamino)methylidene]amino]butyl]piperidine-4-carboxamide;hydroiodide |
| SMILES | CCN/C(=N\CCCCN1CCC(C(N)=O)CC1)N1CCc2cc(OC)c(OC)cc2C1.I |
| InChI | InChI=1S/C24H39N5O3.HI/c1-4-26-24(27-10-5-6-11-28-12-7-18(8-13-28)23(25)30)29-14-9-19-15-21(31-2)22(32-3)16-20(19)17-29;/h15-16,18H,4-14,17H2,1-3H3,(H2,25,30)(H,26,27);1H |
| InChIKey | RIHFTIPOSXTGRG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.52 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|