C11H24N4O2S — CID 111740084
N-ethyl-3,3-dimethyl-N'-(2-sulfamoylethyl)pyrrolidine-1-carboximidamide (PubChem CID 111740084) has the molecular formula C11H24N4O2S and a molecular weight of 276.41 g/mol. Its IUPAC name is N-ethyl-3,3-dimethyl-N'-(2-sulfamoylethyl)pyrrolidine-1-carboximidamide.
| Compound Name | N-ethyl-3,3-dimethyl-N'-(2-sulfamoylethyl)pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111740084 |
| Molecular Formula | C11H24N4O2S |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | N-ethyl-3,3-dimethyl-N'-(2-sulfamoylethyl)pyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCS(N)(=O)=O)N1CCC(C)(C)C1 |
| InChI | InChI=1S/C11H24N4O2S/c1-4-13-10(14-6-8-18(12,16)17)15-7-5-11(2,3)9-15/h4-9H2,1-3H3,(H,13,14)(H2,12,16,17) |
| InChIKey | SMQJIQYTNCOEGZ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|