C13H26N4O4S — CID 111155708
ethyl 1-[N-ethyl-N'-(2-sulfamoylethyl)carbamimidoyl]piperidine-4-carboxylate (PubChem CID 111155708) has the molecular formula C13H26N4O4S and a molecular weight of 334.44 g/mol. Its IUPAC name is ethyl 1-[N-ethyl-N'-(2-sulfamoylethyl)carbamimidoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[N-ethyl-N'-(2-sulfamoylethyl)carbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111155708 |
| Molecular Formula | C13H26N4O4S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | ethyl 1-[N-ethyl-N'-(2-sulfamoylethyl)carbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCN/C(=N\CCS(N)(=O)=O)N1CCC(C(=O)OCC)CC1 |
| InChI | InChI=1S/C13H26N4O4S/c1-3-15-13(16-7-10-22(14,19)20)17-8-5-11(6-9-17)12(18)21-4-2/h11H,3-10H2,1-2H3,(H,15,16)(H2,14,19,20) |
| InChIKey | XBWPASLZHQUEEI-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|