C17H33IN4O4S — CID 111156264
ethyl 1-[N'-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111156264) has the molecular formula C17H33IN4O4S and a molecular weight of 516.45 g/mol. Its IUPAC name is ethyl 1-[N'-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N'-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111156264 |
| Molecular Formula | C17H33IN4O4S |
| Molecular Weight | 516.45 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | ethyl 1-[N'-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCN1CCS(=O)(=O)CC1)N1CCC(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C17H32N4O4S.HI/c1-3-18-17(19-7-10-20-11-13-26(23,24)14-12-20)21-8-5-15(6-9-21)16(22)25-4-2;/h15H,3-14H2,1-2H3,(H,18,19);1H |
| InChIKey | JCDOAXNQZZQMDB-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.45 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|