C25H41N5O2 — CID 111155774
ethyl 1-[N-ethyl-N'-[4-(4-phenylpiperazin-1-yl)butyl]carbamimidoyl]piperidine-4-carboxylate (PubChem CID 111155774) has the molecular formula C25H41N5O2 and a molecular weight of 443.64 g/mol. Its IUPAC name is ethyl 1-[N-ethyl-N'-[4-(4-phenylpiperazin-1-yl)butyl]carbamimidoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[N-ethyl-N'-[4-(4-phenylpiperazin-1-yl)butyl]carbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111155774 |
| Molecular Formula | C25H41N5O2 |
| Molecular Weight | 443.64 g/mol |
| Exact Mass | 443.33 |
| IUPAC Name | ethyl 1-[N-ethyl-N'-[4-(4-phenylpiperazin-1-yl)butyl]carbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCN/C(=N\CCCCN1CCN(c2ccccc2)CC1)N1CCC(C(=O)OCC)CC1 |
| InChI | InChI=1S/C25H41N5O2/c1-3-26-25(30-16-12-22(13-17-30)24(31)32-4-2)27-14-8-9-15-28-18-20-29(21-19-28)23-10-6-5-7-11-23/h5-7,10-11,22H,3-4,8-9,12-21H2,1-2H3,(H,26,27) |
| InChIKey | OPNARVGOKDFQCO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.64 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|