C17H31N3O4 — CID 111157515
ethyl 1-[N-ethyl-N'-(5-methoxy-5-oxopentyl)carbamimidoyl]piperidine-4-carboxylate (PubChem CID 111157515) has the molecular formula C17H31N3O4 and a molecular weight of 341.45 g/mol. Its IUPAC name is ethyl 1-[N-ethyl-N'-(5-methoxy-5-oxopentyl)carbamimidoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[N-ethyl-N'-(5-methoxy-5-oxopentyl)carbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111157515 |
| Molecular Formula | C17H31N3O4 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.23 |
| IUPAC Name | ethyl 1-[N-ethyl-N'-(5-methoxy-5-oxopentyl)carbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCN/C(=N\CCCCC(=O)OC)N1CCC(C(=O)OCC)CC1 |
| InChI | InChI=1S/C17H31N3O4/c1-4-18-17(19-11-7-6-8-15(21)23-3)20-12-9-14(10-13-20)16(22)24-5-2/h14H,4-13H2,1-3H3,(H,18,19) |
| InChIKey | IMOQNFUSYDYZFQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|