C21H35IN4O2 — CID 111156908
ethyl 1-[N-ethyl-N'-[3-(N-methylanilino)propyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111156908) has the molecular formula C21H35IN4O2 and a molecular weight of 502.44 g/mol. Its IUPAC name is ethyl 1-[N-ethyl-N'-[3-(N-methylanilino)propyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N-ethyl-N'-[3-(N-methylanilino)propyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111156908 |
| Molecular Formula | C21H35IN4O2 |
| Molecular Weight | 502.44 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | ethyl 1-[N-ethyl-N'-[3-(N-methylanilino)propyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCCN(C)c1ccccc1)N1CCC(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C21H34N4O2.HI/c1-4-22-21(25-16-12-18(13-17-25)20(26)27-5-2)23-14-9-15-24(3)19-10-7-6-8-11-19;/h6-8,10-11,18H,4-5,9,12-17H2,1-3H3,(H,22,23);1H |
| InChIKey | REAGKXLFWMDCRN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|