C24H41N5O — CID 111959483
4-ethoxy-N-ethyl-N'-[4-(4-phenylpiperazin-1-yl)butyl]piperidine-1-carboximidamide (PubChem CID 111959483) has the molecular formula C24H41N5O and a molecular weight of 415.63 g/mol. Its IUPAC name is 4-ethoxy-N-ethyl-N'-[4-(4-phenylpiperazin-1-yl)butyl]piperidine-1-carboximidamide.
| Compound Name | 4-ethoxy-N-ethyl-N'-[4-(4-phenylpiperazin-1-yl)butyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111959483 |
| Molecular Formula | C24H41N5O |
| Molecular Weight | 415.63 g/mol |
| Exact Mass | 415.33 |
| IUPAC Name | 4-ethoxy-N-ethyl-N'-[4-(4-phenylpiperazin-1-yl)butyl]piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCCCN1CCN(c2ccccc2)CC1)N1CCC(OCC)CC1 |
| InChI | InChI=1S/C24H41N5O/c1-3-25-24(29-16-12-23(13-17-29)30-4-2)26-14-8-9-15-27-18-20-28(21-19-27)22-10-6-5-7-11-22/h5-7,10-11,23H,3-4,8-9,12-21H2,1-2H3,(H,25,26) |
| InChIKey | RQZAKSDJBGQTRA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.63 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|