C24H41IN6O2 — CID 111329323
ethyl 4-[[N-ethyl-N'-[3-(4-phenylpiperazin-1-yl)propyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111329323) has the molecular formula C24H41IN6O2 and a molecular weight of 572.54 g/mol. Its IUPAC name is ethyl 4-[[N-ethyl-N'-[3-(4-phenylpiperazin-1-yl)propyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N-ethyl-N'-[3-(4-phenylpiperazin-1-yl)propyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111329323 |
| Molecular Formula | C24H41IN6O2 |
| Molecular Weight | 572.54 g/mol |
| Exact Mass | 572.23 |
| IUPAC Name | ethyl 4-[[N-ethyl-N'-[3-(4-phenylpiperazin-1-yl)propyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCCN1CCN(c2ccccc2)CC1)NC1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C24H40N6O2.HI/c1-3-25-23(27-21-11-15-30(16-12-21)24(31)32-4-2)26-13-8-14-28-17-19-29(20-18-28)22-9-6-5-7-10-22;/h5-7,9-10,21H,3-4,8,11-20H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | DPWNZHRAVFMUSC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.54 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|