C22H36N6O2 — CID 111059073
ethyl 4-[[N'-[3-(4-phenylpiperazin-1-yl)propyl]carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111059073) has the molecular formula C22H36N6O2 and a molecular weight of 416.57 g/mol. Its IUPAC name is ethyl 4-[[N'-[3-(4-phenylpiperazin-1-yl)propyl]carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N'-[3-(4-phenylpiperazin-1-yl)propyl]carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111059073 |
| Molecular Formula | C22H36N6O2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | ethyl 4-[[N'-[3-(4-phenylpiperazin-1-yl)propyl]carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/CCCN2CCN(c3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C22H36N6O2/c1-2-30-22(29)28-13-9-19(10-14-28)25-21(23)24-11-6-12-26-15-17-27(18-16-26)20-7-4-3-5-8-20/h3-5,7-8,19H,2,6,9-18H2,1H3,(H3,23,24,25) |
| InChIKey | VSUZWMMQACDELI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 86.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|