C20H34N8O2 — CID 111043418
ethyl 4-[[N'-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111043418) has the molecular formula C20H34N8O2 and a molecular weight of 418.55 g/mol. Its IUPAC name is ethyl 4-[[N'-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N'-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111043418 |
| Molecular Formula | C20H34N8O2 |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | ethyl 4-[[N'-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/CCCN2CCN(c3ncccn3)CC2)CC1 |
| InChI | InChI=1S/C20H34N8O2/c1-2-30-20(29)28-11-5-17(6-12-28)25-18(21)22-9-4-10-26-13-15-27(16-14-26)19-23-7-3-8-24-19/h3,7-8,17H,2,4-6,9-16H2,1H3,(H3,21,22,25) |
| InChIKey | FTGIAPQELBJUFP-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|