C17H28IN5O3 — CID 111050747
ethyl 4-[[N'-[(2-ethoxy-3-pyridinyl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111050747) has the molecular formula C17H28IN5O3 and a molecular weight of 477.35 g/mol. Its IUPAC name is ethyl 4-[[N'-[(2-ethoxy-3-pyridinyl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-[(2-ethoxy-3-pyridinyl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111050747 |
| Molecular Formula | C17H28IN5O3 |
| Molecular Weight | 477.35 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | ethyl 4-[[N'-[(2-ethoxy-3-pyridinyl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/Cc2cccnc2OCC)CC1.I |
| InChI | InChI=1S/C17H27N5O3.HI/c1-3-24-15-13(6-5-9-19-15)12-20-16(18)21-14-7-10-22(11-8-14)17(23)25-4-2;/h5-6,9,14H,3-4,7-8,10-12H2,1-2H3,(H3,18,20,21);1H |
| InChIKey | JJIJCRDLIMGBIF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 102.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.35 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|