C16H23F2IN4O2 — CID 111800979
ethyl 4-[[N'-[(2,5-difluorophenyl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111800979) has the molecular formula C16H23F2IN4O2 and a molecular weight of 468.29 g/mol. Its IUPAC name is ethyl 4-[[N'-[(2,5-difluorophenyl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-[(2,5-difluorophenyl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111800979 |
| Molecular Formula | C16H23F2IN4O2 |
| Molecular Weight | 468.29 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | ethyl 4-[[N'-[(2,5-difluorophenyl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/Cc2cc(F)ccc2F)CC1.I |
| InChI | InChI=1S/C16H22F2N4O2.HI/c1-2-24-16(23)22-7-5-13(6-8-22)21-15(19)20-10-11-9-12(17)3-4-14(11)18;/h3-4,9,13H,2,5-8,10H2,1H3,(H3,19,20,21);1H |
| InChIKey | QUNLYVBCEBZDLO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|