C17H23F4IN4O2 — CID 111044997
ethyl 4-[[N'-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111044997) has the molecular formula C17H23F4IN4O2 and a molecular weight of 518.29 g/mol. Its IUPAC name is ethyl 4-[[N'-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111044997 |
| Molecular Formula | C17H23F4IN4O2 |
| Molecular Weight | 518.29 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | ethyl 4-[[N'-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/Cc2ccc(F)cc2C(F)(F)F)CC1.I |
| InChI | InChI=1S/C17H22F4N4O2.HI/c1-2-27-16(26)25-7-5-13(6-8-25)24-15(22)23-10-11-3-4-12(18)9-14(11)17(19,20)21;/h3-4,9,13H,2,5-8,10H2,1H3,(H3,22,23,24);1H |
| InChIKey | BKMZINZNXUORAD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.29 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|