C13H23IN6O2 — CID 111070173
ethyl 4-[[N'-(1H-pyrazol-5-ylmethyl)carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111070173) has the molecular formula C13H23IN6O2 and a molecular weight of 422.27 g/mol. Its IUPAC name is ethyl 4-[[N'-(1H-pyrazol-5-ylmethyl)carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-(1H-pyrazol-5-ylmethyl)carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111070173 |
| Molecular Formula | C13H23IN6O2 |
| Molecular Weight | 422.27 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | ethyl 4-[[N'-(1H-pyrazol-5-ylmethyl)carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/Cc2ccn[nH]2)CC1.I |
| InChI | InChI=1S/C13H22N6O2.HI/c1-2-21-13(20)19-7-4-10(5-8-19)17-12(14)15-9-11-3-6-16-18-11;/h3,6,10H,2,4-5,7-9H2,1H3,(H,16,18)(H3,14,15,17);1H |
| InChIKey | TWIPBVRBSCGEGQ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 108.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|