C15H24N4O2S — CID 111046035
ethyl 4-[[N'-[(5-methylthiophen-2-yl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111046035) has the molecular formula C15H24N4O2S and a molecular weight of 324.45 g/mol. Its IUPAC name is ethyl 4-[[N'-[(5-methylthiophen-2-yl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N'-[(5-methylthiophen-2-yl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111046035 |
| Molecular Formula | C15H24N4O2S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | ethyl 4-[[N'-[(5-methylthiophen-2-yl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/Cc2ccc(C)s2)CC1 |
| InChI | InChI=1S/C15H24N4O2S/c1-3-21-15(20)19-8-6-12(7-9-19)18-14(16)17-10-13-5-4-11(2)22-13/h4-5,12H,3,6-10H2,1-2H3,(H3,16,17,18) |
| InChIKey | YEWPFRUFARFGAY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|