C16H27N5O2S — CID 111822029
ethyl 4-[[N'-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111822029) has the molecular formula C16H27N5O2S and a molecular weight of 353.49 g/mol. Its IUPAC name is ethyl 4-[[N'-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N'-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111822029 |
| Molecular Formula | C16H27N5O2S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | ethyl 4-[[N'-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/CCc2ncc(CC)s2)CC1 |
| InChI | InChI=1S/C16H27N5O2S/c1-3-13-11-19-14(24-13)5-8-18-15(17)20-12-6-9-21(10-7-12)16(22)23-4-2/h11-12H,3-10H2,1-2H3,(H3,17,18,20) |
| InChIKey | GQHQCNJXSQETQF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 92.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|