C15H29IN4O4 — CID 111025635
ethyl 4-[[N'-(4-ethoxy-4-oxobutyl)carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111025635) has the molecular formula C15H29IN4O4 and a molecular weight of 456.33 g/mol. Its IUPAC name is ethyl 4-[[N'-(4-ethoxy-4-oxobutyl)carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-(4-ethoxy-4-oxobutyl)carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111025635 |
| Molecular Formula | C15H29IN4O4 |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | ethyl 4-[[N'-(4-ethoxy-4-oxobutyl)carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)CCC/N=C(\N)NC1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C15H28N4O4.HI/c1-3-22-13(20)6-5-9-17-14(16)18-12-7-10-19(11-8-12)15(21)23-4-2;/h12H,3-11H2,1-2H3,(H3,16,17,18);1H |
| InChIKey | NKGAAYHCQDAWQA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|