C15H29F3IN5O2 — CID 111066494
ethyl 4-[[N'-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111066494) has the molecular formula C15H29F3IN5O2 and a molecular weight of 495.33 g/mol. Its IUPAC name is ethyl 4-[[N'-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111066494 |
| Molecular Formula | C15H29F3IN5O2 |
| Molecular Weight | 495.33 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | ethyl 4-[[N'-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/CCCN(C)CC(F)(F)F)CC1.I |
| InChI | InChI=1S/C15H28F3N5O2.HI/c1-3-25-14(24)23-9-5-12(6-10-23)21-13(19)20-7-4-8-22(2)11-15(16,17)18;/h12H,3-11H2,1-2H3,(H3,19,20,21);1H |
| InChIKey | DLJYNUOVRWDEDN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 83.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|