C16H32IN5O4 — CID 111044619
ethyl 4-[[N'-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111044619) has the molecular formula C16H32IN5O4 and a molecular weight of 485.37 g/mol. Its IUPAC name is ethyl 4-[[N'-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111044619 |
| Molecular Formula | C16H32IN5O4 |
| Molecular Weight | 485.37 g/mol |
| Exact Mass | 485.15 |
| IUPAC Name | ethyl 4-[[N'-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/CCNC(=O)OC(C)(C)C)CC1.I |
| InChI | InChI=1S/C16H31N5O4.HI/c1-5-24-15(23)21-10-6-12(7-11-21)20-13(17)18-8-9-19-14(22)25-16(2,3)4;/h12H,5-11H2,1-4H3,(H,19,22)(H3,17,18,20);1H |
| InChIKey | RSTOAXHETJDZDT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|