C13H27N5O4S — CID 111062597
ethyl 4-[[N'-[2-(ethylsulfonylamino)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111062597) has the molecular formula C13H27N5O4S and a molecular weight of 349.46 g/mol. Its IUPAC name is ethyl 4-[[N'-[2-(ethylsulfonylamino)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N'-[2-(ethylsulfonylamino)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111062597 |
| Molecular Formula | C13H27N5O4S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | ethyl 4-[[N'-[2-(ethylsulfonylamino)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/CCNS(=O)(=O)CC)CC1 |
| InChI | InChI=1S/C13H27N5O4S/c1-3-22-13(19)18-9-5-11(6-10-18)17-12(14)15-7-8-16-23(20,21)4-2/h11,16H,3-10H2,1-2H3,(H3,14,15,17) |
| InChIKey | GTYRMSWYYAIPCA-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 126.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|