C15H29N5O4S2 — CID 111804766
ethyl 4-[[N'-(2-thiomorpholin-4-ylsulfonylethyl)carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111804766) has the molecular formula C15H29N5O4S2 and a molecular weight of 407.56 g/mol. Its IUPAC name is ethyl 4-[[N'-(2-thiomorpholin-4-ylsulfonylethyl)carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N'-(2-thiomorpholin-4-ylsulfonylethyl)carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111804766 |
| Molecular Formula | C15H29N5O4S2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | ethyl 4-[[N'-(2-thiomorpholin-4-ylsulfonylethyl)carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/CCS(=O)(=O)N2CCSCC2)CC1 |
| InChI | InChI=1S/C15H29N5O4S2/c1-2-24-15(21)19-6-3-13(4-7-19)18-14(16)17-5-12-26(22,23)20-8-10-25-11-9-20/h13H,2-12H2,1H3,(H3,16,17,18) |
| InChIKey | PPDWFMKLQRXYCE-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 117.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|