C15H28N4O4S — CID 111722177
ethyl 4-[[N'-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111722177) has the molecular formula C15H28N4O4S and a molecular weight of 360.48 g/mol. Its IUPAC name is ethyl 4-[[N'-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N'-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111722177 |
| Molecular Formula | C15H28N4O4S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | ethyl 4-[[N'-[[1-(methylsulfonylmethyl)cyclopropyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/CC2(CS(C)(=O)=O)CC2)CC1 |
| InChI | InChI=1S/C15H28N4O4S/c1-3-23-14(20)19-8-4-12(5-9-19)18-13(16)17-10-15(6-7-15)11-24(2,21)22/h12H,3-11H2,1-2H3,(H3,16,17,18) |
| InChIKey | XOVFVOQJBPHKDT-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|