C19H27BrN4O2 — CID 111812094
ethyl 4-[[N'-[[1-(3-bromophenyl)cyclopropyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111812094) has the molecular formula C19H27BrN4O2 and a molecular weight of 423.36 g/mol. Its IUPAC name is ethyl 4-[[N'-[[1-(3-bromophenyl)cyclopropyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N'-[[1-(3-bromophenyl)cyclopropyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111812094 |
| Molecular Formula | C19H27BrN4O2 |
| Molecular Weight | 423.36 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | ethyl 4-[[N'-[[1-(3-bromophenyl)cyclopropyl]methyl]carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/CC2(c3cccc(Br)c3)CC2)CC1 |
| InChI | InChI=1S/C19H27BrN4O2/c1-2-26-18(25)24-10-6-16(7-11-24)23-17(21)22-13-19(8-9-19)14-4-3-5-15(20)12-14/h3-5,12,16H,2,6-11,13H2,1H3,(H3,21,22,23) |
| InChIKey | BJEIWYFFNSJBGL-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|