C21H40IN5O4 — CID 110032117
tert-butyl 4-[[[amino-[(1-ethoxycarbonylpiperidin-4-yl)amino]methylidene]amino]methyl]-4-methylpiperidine-1-carboxylate;hydroiodide (PubChem CID 110032117) has the molecular formula C21H40IN5O4 and a molecular weight of 553.49 g/mol. Its IUPAC name is tert-butyl 4-[[[amino-[(1-ethoxycarbonylpiperidin-4-yl)amino]methylidene]amino]methyl]-4-methylpiperidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[[[amino-[(1-ethoxycarbonylpiperidin-4-yl)amino]methylidene]amino]methyl]-4-methylpiperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110032117 |
| Molecular Formula | C21H40IN5O4 |
| Molecular Weight | 553.49 g/mol |
| Exact Mass | 553.21 |
| IUPAC Name | tert-butyl 4-[[[amino-[(1-ethoxycarbonylpiperidin-4-yl)amino]methylidene]amino]methyl]-4-methylpiperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/CC2(C)CCN(C(=O)OC(C)(C)C)CC2)CC1.I |
| InChI | InChI=1S/C21H39N5O4.HI/c1-6-29-18(27)25-11-7-16(8-12-25)24-17(22)23-15-21(5)9-13-26(14-10-21)19(28)30-20(2,3)4;/h16H,6-15H2,1-5H3,(H3,22,23,24);1H |
| InChIKey | HJPDULJFEMJZRX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|