C17H33N5O4 — CID 111044718
ethyl 4-[[N'-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111044718) has the molecular formula C17H33N5O4 and a molecular weight of 371.48 g/mol. Its IUPAC name is ethyl 4-[[N'-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N'-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111044718 |
| Molecular Formula | C17H33N5O4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | ethyl 4-[[N'-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(N)=N/CCCNC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H33N5O4/c1-5-25-16(24)22-11-7-13(8-12-22)21-14(18)19-9-6-10-20-15(23)26-17(2,3)4/h13H,5-12H2,1-4H3,(H,20,23)(H3,18,19,21) |
| InChIKey | DGZZVQGATVCCFI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|