C13H26N4O2S2 — CID 111804808
1-cyclohexyl-2-(2-thiomorpholin-4-ylsulfonylethyl)guanidine (PubChem CID 111804808) has the molecular formula C13H26N4O2S2 and a molecular weight of 334.51 g/mol. Its IUPAC name is 1-cyclohexyl-2-(2-thiomorpholin-4-ylsulfonylethyl)guanidine.
| Compound Name | 1-cyclohexyl-2-(2-thiomorpholin-4-ylsulfonylethyl)guanidine |
|---|---|
| PubChem CID | 111804808 |
| Molecular Formula | C13H26N4O2S2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 1-cyclohexyl-2-(2-thiomorpholin-4-ylsulfonylethyl)guanidine |
| SMILES | N/C(=N\CCS(=O)(=O)N1CCSCC1)NC1CCCCC1 |
| InChI | InChI=1S/C13H26N4O2S2/c14-13(16-12-4-2-1-3-5-12)15-6-11-21(18,19)17-7-9-20-10-8-17/h12H,1-11H2,(H3,14,15,16) |
| InChIKey | QMZAVUARRVMBIZ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|