C17H26N4O2S — CID 111083217
1-cyclohexyl-2-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]guanidine (PubChem CID 111083217) has the molecular formula C17H26N4O2S and a molecular weight of 350.49 g/mol. Its IUPAC name is 1-cyclohexyl-2-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]guanidine.
| Compound Name | 1-cyclohexyl-2-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111083217 |
| Molecular Formula | C17H26N4O2S |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 1-cyclohexyl-2-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]guanidine |
| SMILES | N/C(=N\CCS(=O)(=O)N1CCc2ccccc21)NC1CCCCC1 |
| InChI | InChI=1S/C17H26N4O2S/c18-17(20-15-7-2-1-3-8-15)19-11-13-24(22,23)21-12-10-14-6-4-5-9-16(14)21/h4-6,9,15H,1-3,7-8,10-13H2,(H3,18,19,20) |
| InChIKey | JWCSYFIHYWEVKW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|