C19H33IN4O2S — CID 111083238
2-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-1-(6-methylheptan-2-yl)guanidine;hydroiodide (PubChem CID 111083238) has the molecular formula C19H33IN4O2S and a molecular weight of 508.47 g/mol. Its IUPAC name is 2-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-1-(6-methylheptan-2-yl)guanidine;hydroiodide.
| Compound Name | 2-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-1-(6-methylheptan-2-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111083238 |
| Molecular Formula | C19H33IN4O2S |
| Molecular Weight | 508.47 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | 2-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-1-(6-methylheptan-2-yl)guanidine;hydroiodide |
| SMILES | CC(C)CCCC(C)N/C(N)=N/CCS(=O)(=O)N1CCc2ccccc21.I |
| InChI | InChI=1S/C19H32N4O2S.HI/c1-15(2)7-6-8-16(3)22-19(20)21-12-14-26(24,25)23-13-11-17-9-4-5-10-18(17)23;/h4-5,9-10,15-16H,6-8,11-14H2,1-3H3,(H3,20,21,22);1H |
| InChIKey | PVGZAODMGNTUAL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|