C15H33N3O2S — CID 111812150
2-(2-tert-butylsulfonylethyl)-1-(6-methylheptan-2-yl)guanidine (PubChem CID 111812150) has the molecular formula C15H33N3O2S and a molecular weight of 319.52 g/mol. Its IUPAC name is 2-(2-tert-butylsulfonylethyl)-1-(6-methylheptan-2-yl)guanidine.
| Compound Name | 2-(2-tert-butylsulfonylethyl)-1-(6-methylheptan-2-yl)guanidine |
|---|---|
| PubChem CID | 111812150 |
| Molecular Formula | C15H33N3O2S |
| Molecular Weight | 319.52 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | 2-(2-tert-butylsulfonylethyl)-1-(6-methylheptan-2-yl)guanidine |
| SMILES | CC(C)CCCC(C)N/C(N)=N/CCS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C15H33N3O2S/c1-12(2)8-7-9-13(3)18-14(16)17-10-11-21(19,20)15(4,5)6/h12-13H,7-11H2,1-6H3,(H3,16,17,18) |
| InChIKey | FFLLWTHJYYTHLU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.52 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|