C10H22IN3O2S — CID 136703894
2-(2-tert-butylsulfonylethyl)-1-prop-2-enylguanidine;hydroiodide (PubChem CID 136703894) has the molecular formula C10H22IN3O2S and a molecular weight of 375.28 g/mol. Its IUPAC name is 2-(2-tert-butylsulfonylethyl)-1-prop-2-enylguanidine;hydroiodide.
| Compound Name | 2-(2-tert-butylsulfonylethyl)-1-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 136703894 |
| Molecular Formula | C10H22IN3O2S |
| Molecular Weight | 375.28 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 2-(2-tert-butylsulfonylethyl)-1-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(N)=N/CCS(=O)(=O)C(C)(C)C.I |
| InChI | InChI=1S/C10H21N3O2S.HI/c1-5-6-12-9(11)13-7-8-16(14,15)10(2,3)4;/h5H,1,6-8H2,2-4H3,(H3,11,12,13);1H |
| InChIKey | BPYZCEQEJUQCHB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|