C11H26IN3O2S — CID 111123497
1-butan-2-yl-2-(2-tert-butylsulfonylethyl)guanidine;hydroiodide (PubChem CID 111123497) has the molecular formula C11H26IN3O2S and a molecular weight of 391.32 g/mol. Its IUPAC name is 1-butan-2-yl-2-(2-tert-butylsulfonylethyl)guanidine;hydroiodide.
| Compound Name | 1-butan-2-yl-2-(2-tert-butylsulfonylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111123497 |
| Molecular Formula | C11H26IN3O2S |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 1-butan-2-yl-2-(2-tert-butylsulfonylethyl)guanidine;hydroiodide |
| SMILES | CCC(C)N/C(N)=N/CCS(=O)(=O)C(C)(C)C.I |
| InChI | InChI=1S/C11H25N3O2S.HI/c1-6-9(2)14-10(12)13-7-8-17(15,16)11(3,4)5;/h9H,6-8H2,1-5H3,(H3,12,13,14);1H |
| InChIKey | GLHKEJDJMMJPNL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|