C10H22N4O — CID 110920182
3-[[amino-(butan-2-ylamino)methylidene]amino]-2,2-dimethylpropanamide (PubChem CID 110920182) has the molecular formula C10H22N4O and a molecular weight of 214.31 g/mol. Its IUPAC name is 3-[[amino-(butan-2-ylamino)methylidene]amino]-2,2-dimethylpropanamide.
| Compound Name | 3-[[amino-(butan-2-ylamino)methylidene]amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 110920182 |
| Molecular Formula | C10H22N4O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | 3-[[amino-(butan-2-ylamino)methylidene]amino]-2,2-dimethylpropanamide |
| SMILES | CCC(C)N/C(N)=N/CC(C)(C)C(N)=O |
| InChI | InChI=1S/C10H22N4O/c1-5-7(2)14-9(12)13-6-10(3,4)8(11)15/h7H,5-6H2,1-4H3,(H2,11,15)(H3,12,13,14) |
| InChIKey | QVQBMMDJIQXWNZ-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|