C8H20IN3O2S — CID 110920553
1-butan-2-yl-2-(2-methylsulfonylethyl)guanidine;hydroiodide (PubChem CID 110920553) has the molecular formula C8H20IN3O2S and a molecular weight of 349.24 g/mol. Its IUPAC name is 1-butan-2-yl-2-(2-methylsulfonylethyl)guanidine;hydroiodide.
| Compound Name | 1-butan-2-yl-2-(2-methylsulfonylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110920553 |
| Molecular Formula | C8H20IN3O2S |
| Molecular Weight | 349.24 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 1-butan-2-yl-2-(2-methylsulfonylethyl)guanidine;hydroiodide |
| SMILES | CCC(C)N/C(N)=N/CCS(C)(=O)=O.I |
| InChI | InChI=1S/C8H19N3O2S.HI/c1-4-7(2)11-8(9)10-5-6-14(3,12)13;/h7H,4-6H2,1-3H3,(H3,9,10,11);1H |
| InChIKey | AVHOXZVJQYAYIP-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.24 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|