C8H19N3O2S — CID 62362658
2-(3-methylsulfonylpropyl)-1-propan-2-ylguanidine (PubChem CID 62362658) has the molecular formula C8H19N3O2S and a molecular weight of 221.33 g/mol. Its IUPAC name is 2-(3-methylsulfonylpropyl)-1-propan-2-ylguanidine.
| Compound Name | 2-(3-methylsulfonylpropyl)-1-propan-2-ylguanidine |
|---|---|
| PubChem CID | 62362658 |
| Molecular Formula | C8H19N3O2S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2-(3-methylsulfonylpropyl)-1-propan-2-ylguanidine |
| SMILES | CC(C)N/C(N)=N/CCCS(C)(=O)=O |
| InChI | InChI=1S/C8H19N3O2S/c1-7(2)11-8(9)10-5-4-6-14(3,12)13/h7H,4-6H2,1-3H3,(H3,9,10,11) |
| InChIKey | KYUARVBBUMLLTK-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|