C11H25IN4O — CID 110919216
3-[[amino-(butan-2-ylamino)methylidene]amino]-N-propan-2-ylpropanamide;hydroiodide (PubChem CID 110919216) has the molecular formula C11H25IN4O and a molecular weight of 356.25 g/mol. Its IUPAC name is 3-[[amino-(butan-2-ylamino)methylidene]amino]-N-propan-2-ylpropanamide;hydroiodide.
| Compound Name | 3-[[amino-(butan-2-ylamino)methylidene]amino]-N-propan-2-ylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 110919216 |
| Molecular Formula | C11H25IN4O |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 3-[[amino-(butan-2-ylamino)methylidene]amino]-N-propan-2-ylpropanamide;hydroiodide |
| SMILES | CCC(C)N/C(N)=N/CCC(=O)NC(C)C.I |
| InChI | InChI=1S/C11H24N4O.HI/c1-5-9(4)15-11(12)13-7-6-10(16)14-8(2)3;/h8-9H,5-7H2,1-4H3,(H,14,16)(H3,12,13,15);1H |
| InChIKey | XCEQTTBKABMEMQ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|