C11H25IN4O — CID 111043505
3-[bis(dimethylamino)methylideneamino]-N-propan-2-ylpropanamide;hydroiodide (PubChem CID 111043505) has the molecular formula C11H25IN4O and a molecular weight of 356.25 g/mol. Its IUPAC name is 3-[bis(dimethylamino)methylideneamino]-N-propan-2-ylpropanamide;hydroiodide.
| Compound Name | 3-[bis(dimethylamino)methylideneamino]-N-propan-2-ylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111043505 |
| Molecular Formula | C11H25IN4O |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 3-[bis(dimethylamino)methylideneamino]-N-propan-2-ylpropanamide;hydroiodide |
| SMILES | CC(C)NC(=O)CCN=C(N(C)C)N(C)C.I |
| InChI | InChI=1S/C11H24N4O.HI/c1-9(2)13-10(16)7-8-12-11(14(3)4)15(5)6;/h9H,7-8H2,1-6H3,(H,13,16);1H |
| InChIKey | UXTDAJGKLNSIHQ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|