About methyl 7-[bis(dimethylamino)methylideneamino]heptanoate;hydroiodide
methyl 7-[bis(dimethylamino)methylideneamino]heptanoate;hydroiodide (PubChem CID 111040562) has the molecular formula C13H28IN3O2
and a molecular weight of 385.29 g/mol. Its IUPAC name is methyl 7-[bis(dimethylamino)methylideneamino]heptanoate;hydroiodide.
Molecular Properties
| Compound Name | methyl 7-[bis(dimethylamino)methylideneamino]heptanoate;hydroiodide |
| PubChem CID | 111040562 |
| Molecular Formula | C13H28IN3O2 |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | methyl 7-[bis(dimethylamino)methylideneamino]heptanoate;hydroiodide |
| SMILES | COC(=O)CCCCCCN=C(N(C)C)N(C)C.I |
| InChI | InChI=1S/C13H27N3O2.HI/c1-15(2)13(16(3)4)14-11-9-7-6-8-10-12(17)18-5;/h6-11H2,1-5H3;1H |
| InChIKey | ALNXAEBVAINNMQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 45.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl 7-[bis(dimethylamino)methylideneamino]heptanoate;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 7-[bis(dimethylamino)methylideneamino]heptanoate;hydroiodide?
The IUPAC name of methyl 7-[bis(dimethylamino)methylideneamino]heptanoate;hydroiodide (CID 111040562) is methyl 7-[bis(dimethylamino)methylideneamino]heptanoate;hydroiodide.
What is the SMILES notation for methyl 7-[bis(dimethylamino)methylideneamino]heptanoate;hydroiodide?
The canonical SMILES for methyl 7-[bis(dimethylamino)methylideneamino]heptanoate;hydroiodide is COC(=O)CCCCCCN=C(N(C)C)N(C)C.I.
What is the InChIKey of methyl 7-[bis(dimethylamino)methylideneamino]heptanoate;hydroiodide?
The InChIKey is ALNXAEBVAINNMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N3O2.HI/c1-15(2)13(16(3)4)14-11-9-7-6-8-10-12(17)18-5;/h6-11H2,1-5H3;1H.
What are the key properties of methyl 7-[bis(dimethylamino)methylideneamino]heptanoate;hydroiodide?
methyl 7-[bis(dimethylamino)methylideneamino]heptanoate;hydroiodide has a molecular weight of 385.29 g/mol, XLogP of 2.21, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-[bis(dimethylamino)methylideneamino]heptanoate;hydroiodide is sourced from PubChem (CID 111040562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).