C15H33N3 — CID 13127985
2-decyl-1,1,3,3-tetramethylguanidine (PubChem CID 13127985) has the molecular formula C15H33N3 and a molecular weight of 255.45 g/mol. Its IUPAC name is 2-decyl-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-decyl-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 13127985 |
| Molecular Formula | C15H33N3 |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.27 |
| IUPAC Name | 2-decyl-1,1,3,3-tetramethylguanidine |
| SMILES | CCCCCCCCCCN=C(N(C)C)N(C)C |
| InChI | InChI=1S/C15H33N3/c1-6-7-8-9-10-11-12-13-14-16-15(17(2)3)18(4)5/h6-14H2,1-5H3 |
| InChIKey | LXAAEFRNYANHEH-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|