C12H29IN4 — CID 111025375
2-[3-(diethylamino)propyl]-1,1,3,3-tetramethylguanidine;hydroiodide (PubChem CID 111025375) has the molecular formula C12H29IN4 and a molecular weight of 356.30 g/mol. Its IUPAC name is 2-[3-(diethylamino)propyl]-1,1,3,3-tetramethylguanidine;hydroiodide.
| Compound Name | 2-[3-(diethylamino)propyl]-1,1,3,3-tetramethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111025375 |
| Molecular Formula | C12H29IN4 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 2-[3-(diethylamino)propyl]-1,1,3,3-tetramethylguanidine;hydroiodide |
| SMILES | CCN(CC)CCCN=C(N(C)C)N(C)C.I |
| InChI | InChI=1S/C12H28N4.HI/c1-7-16(8-2)11-9-10-13-12(14(3)4)15(5)6;/h7-11H2,1-6H3;1H |
| InChIKey | WTXYZAPWPZJMGU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|