C8H21N3O3Si — CID 135038431
1,1,3,3-tetramethyl-2-(3-trihydroxysilylpropyl)guanidine (PubChem CID 135038431) has the molecular formula C8H21N3O3Si and a molecular weight of 235.36 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-(3-trihydroxysilylpropyl)guanidine.
| Compound Name | 1,1,3,3-tetramethyl-2-(3-trihydroxysilylpropyl)guanidine |
|---|---|
| PubChem CID | 135038431 |
| Molecular Formula | C8H21N3O3Si |
| Molecular Weight | 235.36 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-(3-trihydroxysilylpropyl)guanidine |
| SMILES | CN(C)C(=NCCC[Si](O)(O)O)N(C)C |
| InChI | InChI=1S/C8H21N3O3Si/c1-10(2)8(11(3)4)9-6-5-7-15(12,13)14/h12-14H,5-7H2,1-4H3 |
| InChIKey | YMFVISSYGOPFLE-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.36 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|