C12H28IN3O2 — CID 111095275
2-[4-(2-methoxyethoxy)butyl]-1,1,3,3-tetramethylguanidine;hydroiodide (PubChem CID 111095275) has the molecular formula C12H28IN3O2 and a molecular weight of 373.28 g/mol. Its IUPAC name is 2-[4-(2-methoxyethoxy)butyl]-1,1,3,3-tetramethylguanidine;hydroiodide.
| Compound Name | 2-[4-(2-methoxyethoxy)butyl]-1,1,3,3-tetramethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111095275 |
| Molecular Formula | C12H28IN3O2 |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 2-[4-(2-methoxyethoxy)butyl]-1,1,3,3-tetramethylguanidine;hydroiodide |
| SMILES | COCCOCCCCN=C(N(C)C)N(C)C.I |
| InChI | InChI=1S/C12H27N3O2.HI/c1-14(2)12(15(3)4)13-8-6-7-9-17-11-10-16-5;/h6-11H2,1-5H3;1H |
| InChIKey | CBHBESVARMJKNB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 37.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|