C10H23IN4O2 — CID 111037025
2-[bis(dimethylamino)methylideneamino]-N-(2-methoxyethyl)acetamide;hydroiodide (PubChem CID 111037025) has the molecular formula C10H23IN4O2 and a molecular weight of 358.22 g/mol. Its IUPAC name is 2-[bis(dimethylamino)methylideneamino]-N-(2-methoxyethyl)acetamide;hydroiodide.
| Compound Name | 2-[bis(dimethylamino)methylideneamino]-N-(2-methoxyethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111037025 |
| Molecular Formula | C10H23IN4O2 |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 2-[bis(dimethylamino)methylideneamino]-N-(2-methoxyethyl)acetamide;hydroiodide |
| SMILES | COCCNC(=O)CN=C(N(C)C)N(C)C.I |
| InChI | InChI=1S/C10H22N4O2.HI/c1-13(2)10(14(3)4)12-8-9(15)11-6-7-16-5;/h6-8H2,1-5H3,(H,11,15);1H |
| InChIKey | NTHPPHDHMCDNHY-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|