C9H21IN4O2 — CID 111036987
2-[[amino(propylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide;hydroiodide (PubChem CID 111036987) has the molecular formula C9H21IN4O2 and a molecular weight of 344.20 g/mol. Its IUPAC name is 2-[[amino(propylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide;hydroiodide.
| Compound Name | 2-[[amino(propylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111036987 |
| Molecular Formula | C9H21IN4O2 |
| Molecular Weight | 344.20 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 2-[[amino(propylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide;hydroiodide |
| SMILES | CCCN/C(N)=N/CC(=O)NCCOC.I |
| InChI | InChI=1S/C9H20N4O2.HI/c1-3-4-12-9(10)13-7-8(14)11-5-6-15-2;/h3-7H2,1-2H3,(H,11,14)(H3,10,12,13);1H |
| InChIKey | CKUNXPNQRVLMNF-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.20 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|